C26H24I2N4O3S — CID 40736259
(2R)-N-[[4-[(4-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide (PubChem CID 40736259) has the molecular formula C26H24I2N4O3S and a molecular weight of 726.38 g/mol. Its IUPAC name is (2R)-N-[[4-[(4-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide.
| Compound Name | (2R)-N-[[4-[(4-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 40736259 |
| Molecular Formula | C26H24I2N4O3S |
| Molecular Weight | 726.38 g/mol |
| Exact Mass | 725.97 |
| IUPAC Name | (2R)-N-[[4-[(4-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-methyl-2-[(2-thiophen-2-ylacetyl)amino]butanamide |
| SMILES | CC(C)[C@@H](NC(=O)Cc1cccs1)C(=O)NN=Cc1cc(I)c(OCc2ccc(C#N)cc2)c(I)c1 |
| InChI | InChI=1S/C26H24I2N4O3S/c1-16(2)24(31-23(33)12-20-4-3-9-36-20)26(34)32-30-14-19-10-21(27)25(22(28)11-19)35-15-18-7-5-17(13-29)6-8-18/h3-11,14,16,24H,12,15H2,1-2H3,(H,31,33)(H,32,34)/t24-/m1/s1 |
| InChIKey | DWHGAGJAFNWXDC-XMMPIXPASA-N |
| XLogP | 5.24 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|