C17H14F3N3O2S2 — CID 71696204
(E)-N-[[(2-thiophen-2-ylacetyl)amino]carbamothioyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 71696204) has the molecular formula C17H14F3N3O2S2 and a molecular weight of 413.45 g/mol. Its IUPAC name is (E)-N-[[(2-thiophen-2-ylacetyl)amino]carbamothioyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[(2-thiophen-2-ylacetyl)amino]carbamothioyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71696204 |
| Molecular Formula | C17H14F3N3O2S2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (E)-N-[[(2-thiophen-2-ylacetyl)amino]carbamothioyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)NC(=S)NNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C17H14F3N3O2S2/c18-17(19,20)12-6-3-11(4-7-12)5-8-14(24)21-16(26)23-22-15(25)10-13-2-1-9-27-13/h1-9H,10H2,(H,22,25)(H2,21,23,24,26)/b8-5+ |
| InChIKey | VLHQIMJOMAPEPX-VMPITWQZSA-N |
| XLogP | 3.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|