C26H25Cl2N7O4S — CID 70158307
2-N-[2-(4-chloroanilino)ethyl]-3-N-[2-(4-chlorophenyl)sulfonyl-2-[(3-nitro-2-pyridinyl)amino]ethyl]pyridine-2,3-diamine (PubChem CID 70158307) has the molecular formula C26H25Cl2N7O4S and a molecular weight of 602.50 g/mol. Its IUPAC name is 2-N-[2-(4-chloroanilino)ethyl]-3-N-[2-(4-chlorophenyl)sulfonyl-2-[(3-nitro-2-pyridinyl)amino]ethyl]pyridine-2,3-diamine.
| Compound Name | 2-N-[2-(4-chloroanilino)ethyl]-3-N-[2-(4-chlorophenyl)sulfonyl-2-[(3-nitro-2-pyridinyl)amino]ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 70158307 |
| Molecular Formula | C26H25Cl2N7O4S |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | 2-N-[2-(4-chloroanilino)ethyl]-3-N-[2-(4-chlorophenyl)sulfonyl-2-[(3-nitro-2-pyridinyl)amino]ethyl]pyridine-2,3-diamine |
| SMILES | O=[N+]([O-])c1cccnc1NC(CNc1cccnc1NCCNc1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25Cl2N7O4S/c27-18-5-9-20(10-6-18)29-15-16-32-25-22(3-1-13-30-25)33-17-24(34-26-23(35(36)37)4-2-14-31-26)40(38,39)21-11-7-19(28)8-12-21/h1-14,24,29,33H,15-17H2,(H,30,32)(H,31,34) |
| InChIKey | MCSGAXNMSJLFLX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|