C24H25ClF3N3O2 — CID 70162087
N-[4-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-2-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 70162087) has the molecular formula C24H25ClF3N3O2 and a molecular weight of 479.93 g/mol. Its IUPAC name is N-[4-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-2-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-[4-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-2-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 70162087 |
| Molecular Formula | C24H25ClF3N3O2 |
| Molecular Weight | 479.93 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[4-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-2-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc2c(c1)[C@H]1CN(CCCCNC(=O)c3ccccc3C(F)(F)F)C[C@@H]1CO2 |
| InChI | InChI=1S/C24H24F3N3O2.ClH/c25-24(26,27)21-6-2-1-5-18(21)23(31)29-9-3-4-10-30-13-17-15-32-22-8-7-16(12-28)11-19(22)20(17)14-30;/h1-2,5-8,11,17,20H,3-4,9-10,13-15H2,(H,29,31);1H/t17-,20+;/m1./s1 |
| InChIKey | JITIKIQGUICVFR-XLCHORMMSA-N |
| XLogP | 4.62 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|