C10H12N2O2 — CID 7016241
(4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 7016241) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 7016241 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1ccc(C[C@@H]2COC(=O)N2)cc1 |
| InChI | InChI=1S/C10H12N2O2/c11-8-3-1-7(2-4-8)5-9-6-14-10(13)12-9/h1-4,9H,5-6,11H2,(H,12,13)/t9-/m1/s1 |
| InChIKey | WNAVSKJKDPLWBD-SECBINFHSA-N |
| XLogP | 0.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|