C21H23ClN4O5S — CID 70162693
N-[3-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 70162693) has the molecular formula C21H23ClN4O5S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-[3-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 70162693 |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[3-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc2c(c1)[C@H]1CN(CCCNS(=O)(=O)c3ccc([N+](=O)[O-])cc3)C[C@@H]1CO2 |
| InChI | InChI=1S/C21H22N4O5S.ClH/c22-11-15-2-7-21-19(10-15)20-13-24(12-16(20)14-30-21)9-1-8-23-31(28,29)18-5-3-17(4-6-18)25(26)27;/h2-7,10,16,20,23H,1,8-9,12-14H2;1H/t16-,20+;/m1./s1 |
| InChIKey | UCFXKNSBVQSGTM-PXPMWPIZSA-N |
| XLogP | 2.66 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|