C29H28F3N3O4 — CID 70163628
4-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]-N-(2,2,2-trifluoroethyl)quinoline-8-carboxamide (PubChem CID 70163628) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]-N-(2,2,2-trifluoroethyl)quinoline-8-carboxamide.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]-N-(2,2,2-trifluoroethyl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 70163628 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenoxy]-N-(2,2,2-trifluoroethyl)quinoline-8-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc2c(Oc3ccc(CCNC[C@H](O)COc4ccccc4)cc3)ccnc12 |
| InChI | InChI=1S/C29H28F3N3O4/c30-29(31,32)19-35-28(37)25-8-4-7-24-26(14-16-34-27(24)25)39-23-11-9-20(10-12-23)13-15-33-17-21(36)18-38-22-5-2-1-3-6-22/h1-12,14,16,21,33,36H,13,15,17-19H2,(H,35,37)/t21-/m0/s1 |
| InChIKey | FSOXNLISHYBNMD-NRFANRHFSA-N |
| XLogP | 4.89 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|