C24H28F3NO5 — CID 70166401
2-[[(1R,2S)-6-methoxy-1-(3-methylphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl-methylamino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 70166401) has the molecular formula C24H28F3NO5 and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-[[(1R,2S)-6-methoxy-1-(3-methylphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl-methylamino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(1R,2S)-6-methoxy-1-(3-methylphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl-methylamino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70166401 |
| Molecular Formula | C24H28F3NO5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[[(1R,2S)-6-methoxy-1-(3-methylphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl-methylamino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c(c1)CC[C@H](CN(C)CC(=O)O)[C@@H]2c1cccc(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27NO3.C2HF3O2/c1-15-5-4-6-17(11-15)22-18(13-23(2)14-21(24)25)8-7-16-12-19(26-3)9-10-20(16)22;3-2(4,5)1(6)7/h4-6,9-12,18,22H,7-8,13-14H2,1-3H3,(H,24,25);(H,6,7)/t18-,22+;/m1./s1 |
| InChIKey | UWMXDZMQFWDUHT-MYXGOWFTSA-N |
| XLogP | 4.35 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |