C28H37FN4O3 — CID 70174304
2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(5-methyl-1H-pyrazol-4-yl)butyl]piperidin-3-yl]acetic acid (PubChem CID 70174304) has the molecular formula C28H37FN4O3 and a molecular weight of 496.63 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(5-methyl-1H-pyrazol-4-yl)butyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(5-methyl-1H-pyrazol-4-yl)butyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70174304 |
| Molecular Formula | C28H37FN4O3 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(5-methyl-1H-pyrazol-4-yl)butyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCCc4cn[nH]c4C)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H37FN4O3/c1-19-21(17-31-32-19)5-3-4-13-33-14-11-20(22(18-33)15-28(34)35)6-8-26(29)24-10-12-30-27-9-7-23(36-2)16-25(24)27/h7,9-10,12,16-17,20,22,26H,3-6,8,11,13-15,18H2,1-2H3,(H,31,32)(H,34,35)/t20-,22+,26?/m1/s1 |
| InChIKey | RHPVRIQDIBIUMF-VBCRPWMOSA-N |
| XLogP | 5.50 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|