C27H34N6O6 — CID 70179102
N-(2-amino-2-oxoethyl)-N-[4-(diethylamino)phenyl]-2-[3-(3,3-dimethyl-2-oxobutyl)-5-nitro-2-oxobenzimidazol-1-yl]acetamide (PubChem CID 70179102) has the molecular formula C27H34N6O6 and a molecular weight of 538.61 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-[4-(diethylamino)phenyl]-2-[3-(3,3-dimethyl-2-oxobutyl)-5-nitro-2-oxobenzimidazol-1-yl]acetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-[4-(diethylamino)phenyl]-2-[3-(3,3-dimethyl-2-oxobutyl)-5-nitro-2-oxobenzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 70179102 |
| Molecular Formula | C27H34N6O6 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-[4-(diethylamino)phenyl]-2-[3-(3,3-dimethyl-2-oxobutyl)-5-nitro-2-oxobenzimidazol-1-yl]acetamide |
| SMILES | CCN(CC)c1ccc(N(CC(N)=O)C(=O)Cn2c(=O)n(CC(=O)C(C)(C)C)c3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C27H34N6O6/c1-6-29(7-2)18-8-10-19(11-9-18)30(16-24(28)35)25(36)17-32-21-13-12-20(33(38)39)14-22(21)31(26(32)37)15-23(34)27(3,4)5/h8-14H,6-7,15-17H2,1-5H3,(H2,28,35) |
| InChIKey | KFRKUCQPFVGUEN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|