C28H35NO — CID 70183549
N-ethyl-3-[2-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enamide (PubChem CID 70183549) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is N-ethyl-3-[2-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enamide.
| Compound Name | N-ethyl-3-[2-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70183549 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | N-ethyl-3-[2-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enamide |
| SMILES | CCNC(=O)C=Cc1ccccc1C1(c2ccc3c(c2)C(C)(C)CCC3(C)C)CC1 |
| InChI | InChI=1S/C28H35NO/c1-6-29-25(30)14-11-20-9-7-8-10-22(20)28(17-18-28)21-12-13-23-24(19-21)27(4,5)16-15-26(23,2)3/h7-14,19H,6,15-18H2,1-5H3,(H,29,30) |
| InChIKey | HSBJKGVUPDDKEB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|