C22H26FN3O6S — CID 70184072
1-O-tert-butyl 3-O-[[4-(4-fluorophenyl)phenyl]sulfonylamino] (3R)-piperazine-1,3-dicarboxylate (PubChem CID 70184072) has the molecular formula C22H26FN3O6S and a molecular weight of 479.53 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[[4-(4-fluorophenyl)phenyl]sulfonylamino] (3R)-piperazine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-[[4-(4-fluorophenyl)phenyl]sulfonylamino] (3R)-piperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70184072 |
| Molecular Formula | C22H26FN3O6S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 1-O-tert-butyl 3-O-[[4-(4-fluorophenyl)phenyl]sulfonylamino] (3R)-piperazine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C(=O)ONS(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C22H26FN3O6S/c1-22(2,3)31-21(28)26-13-12-24-19(14-26)20(27)32-25-33(29,30)18-10-6-16(7-11-18)15-4-8-17(23)9-5-15/h4-11,19,24-25H,12-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | RDZQMOSPSCJTHO-LJQANCHMSA-N |
| XLogP | 2.44 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|