C25H40N4O6 — CID 70185311
2-amino-6-[[(7S,8S)-7-[(S)-amino(morpholin-4-yl)methyl]-8-hydroxy-6-oxo-8-phenyloctanoyl]amino]hexanoic acid (PubChem CID 70185311) has the molecular formula C25H40N4O6 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-amino-6-[[(7S,8S)-7-[(S)-amino(morpholin-4-yl)methyl]-8-hydroxy-6-oxo-8-phenyloctanoyl]amino]hexanoic acid.
| Compound Name | 2-amino-6-[[(7S,8S)-7-[(S)-amino(morpholin-4-yl)methyl]-8-hydroxy-6-oxo-8-phenyloctanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 70185311 |
| Molecular Formula | C25H40N4O6 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 2-amino-6-[[(7S,8S)-7-[(S)-amino(morpholin-4-yl)methyl]-8-hydroxy-6-oxo-8-phenyloctanoyl]amino]hexanoic acid |
| SMILES | NC(CCCCNC(=O)CCCCC(=O)[C@H]([C@H](O)c1ccccc1)[C@@H](N)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C25H40N4O6/c26-19(25(33)34)10-6-7-13-28-21(31)12-5-4-11-20(30)22(23(32)18-8-2-1-3-9-18)24(27)29-14-16-35-17-15-29/h1-3,8-9,19,22-24,32H,4-7,10-17,26-27H2,(H,28,31)(H,33,34)/t19?,22-,23-,24+/m1/s1 |
| InChIKey | IKILIUOFZXJHAM-CTZQHGRUSA-N |
| XLogP | 0.78 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|