C27H30N4O8S — CID 70186461
1-(1,3-benzothiazol-2-yl)-2-(4-phenylpiperazin-1-yl)ethanamine;bis((E)-but-2-enedioic acid) (PubChem CID 70186461) has the molecular formula C27H30N4O8S and a molecular weight of 570.62 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-(4-phenylpiperazin-1-yl)ethanamine;bis((E)-but-2-enedioic acid).
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-(4-phenylpiperazin-1-yl)ethanamine;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 70186461 |
| Molecular Formula | C27H30N4O8S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-(4-phenylpiperazin-1-yl)ethanamine;bis((E)-but-2-enedioic acid) |
| SMILES | NC(CN1CCN(c2ccccc2)CC1)c1nc2ccccc2s1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H22N4S.2C4H4O4/c20-16(19-21-17-8-4-5-9-18(17)24-19)14-22-10-12-23(13-11-22)15-6-2-1-3-7-15;2*5-3(6)1-2-4(7)8/h1-9,16H,10-14,20H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | WZBDIHJOAQOHQX-LVEZLNDCSA-N |
| XLogP | 2.54 |
| TPSA | 194.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|