C11H9F3N4 — CID 7018671
[4-(difluoromethyl)-6-(4-fluorophenyl)pyrimidin-2-yl]hydrazine (PubChem CID 7018671) has the molecular formula C11H9F3N4 and a molecular weight of 254.22 g/mol. Its IUPAC name is [4-(difluoromethyl)-6-(4-fluorophenyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(difluoromethyl)-6-(4-fluorophenyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 7018671 |
| Molecular Formula | C11H9F3N4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [4-(difluoromethyl)-6-(4-fluorophenyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(F)cc2)cc(C(F)F)n1 |
| InChI | InChI=1S/C11H9F3N4/c12-7-3-1-6(2-4-7)8-5-9(10(13)14)17-11(16-8)18-15/h1-5,10H,15H2,(H,16,17,18) |
| InChIKey | SPYHWIQCEGJKHN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|