C15H15N2O2P — CID 70187958
N,N-dibenzyl-cyanophosphonamidic acid (PubChem CID 70187958) has the molecular formula C15H15N2O2P and a molecular weight of 286.27 g/mol. Its IUPAC name is N,N-dibenzyl-cyanophosphonamidic acid.
| Compound Name | N,N-dibenzyl-cyanophosphonamidic acid |
|---|---|
| PubChem CID | 70187958 |
| Molecular Formula | C15H15N2O2P |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N,N-dibenzyl-cyanophosphonamidic acid |
| SMILES | N#CP(=O)(O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15N2O2P/c16-13-20(18,19)17(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10H,11-12H2,(H,18,19) |
| InChIKey | VFCNSRCGYLPTBX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|