C35H32Cl2N3O2P — CID 139199338
N-bis(dibenzylamino)phosphoryl-2,6-dichlorobenzamide (PubChem CID 139199338) has the molecular formula C35H32Cl2N3O2P and a molecular weight of 628.54 g/mol. Its IUPAC name is N-bis(dibenzylamino)phosphoryl-2,6-dichlorobenzamide.
| Compound Name | N-bis(dibenzylamino)phosphoryl-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 139199338 |
| Molecular Formula | C35H32Cl2N3O2P |
| Molecular Weight | 628.54 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | N-bis(dibenzylamino)phosphoryl-2,6-dichlorobenzamide |
| SMILES | O=C(NP(=O)(N(Cc1ccccc1)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C35H32Cl2N3O2P/c36-32-22-13-23-33(37)34(32)35(41)38-43(42,39(24-28-14-5-1-6-15-28)25-29-16-7-2-8-17-29)40(26-30-18-9-3-10-19-30)27-31-20-11-4-12-21-31/h1-23H,24-27H2,(H,38,41,42) |
| InChIKey | QFNDOMPAAAFVRV-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.54 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|