C22H22Cl2N2O2 — CID 7176958
N-[benzyl-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamoyl]-2,6-dichlorobenzamide (PubChem CID 7176958) has the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is N-[benzyl-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamoyl]-2,6-dichlorobenzamide.
| Compound Name | N-[benzyl-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamoyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 7176958 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[benzyl-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamoyl]-2,6-dichlorobenzamide |
| SMILES | O=C(NC(=O)N(Cc1ccccc1)[C@@H]1C[C@H]2CC[C@H]1C2)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H22Cl2N2O2/c23-17-7-4-8-18(24)20(17)21(27)25-22(28)26(13-14-5-2-1-3-6-14)19-12-15-9-10-16(19)11-15/h1-8,15-16,19H,9-13H2,(H,25,27,28)/t15-,16-,19+/m0/s1 |
| InChIKey | HAZNMFGNLXWTQJ-TXPKVOOTSA-N |
| XLogP | 5.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |