C13H16NO2S- — CID 57371803
N-(2-bicyclo[2.2.1]heptanyl)-N-(thiophen-2-ylmethyl)carbamate (PubChem CID 57371803) has the molecular formula C13H16NO2S- and a molecular weight of 250.34 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-N-(thiophen-2-ylmethyl)carbamate.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-N-(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 57371803 |
| Molecular Formula | C13H16NO2S- |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-N-(thiophen-2-ylmethyl)carbamate |
| SMILES | O=C([O-])N(Cc1cccs1)C1CC2CCC1C2 |
| InChI | InChI=1S/C13H17NO2S/c15-13(16)14(8-11-2-1-5-17-11)12-7-9-3-4-10(12)6-9/h1-2,5,9-10,12H,3-4,6-8H2,(H,15,16)/p-1 |
| InChIKey | GHGAHQOYFYEEJS-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |