C30H30Cl2N3O2P — CID 102300965
N-bis(dibenzylamino)phosphoryl-2,2-dichloroacetamide (PubChem CID 102300965) has the molecular formula C30H30Cl2N3O2P and a molecular weight of 566.47 g/mol. Its IUPAC name is N-bis(dibenzylamino)phosphoryl-2,2-dichloroacetamide.
| Compound Name | N-bis(dibenzylamino)phosphoryl-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 102300965 |
| Molecular Formula | C30H30Cl2N3O2P |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | N-bis(dibenzylamino)phosphoryl-2,2-dichloroacetamide |
| SMILES | O=C(NP(=O)(N(Cc1ccccc1)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C30H30Cl2N3O2P/c31-29(32)30(36)33-38(37,34(21-25-13-5-1-6-14-25)22-26-15-7-2-8-16-26)35(23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28/h1-20,29H,21-24H2,(H,33,36,37) |
| InChIKey | AFJKNKADOWZLHT-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|