C29H26N2O7S — CID 70191260
2-(1,3-benzodioxol-5-yl)-2-(6-ethyl-3-oxo-2-oxa-6-azatricyclo[5.3.1.04,8]undeca-1(11),4,7,9-tetraen-5-yl)-N-(4-propan-2-ylphenyl)sulfonylacetamide (PubChem CID 70191260) has the molecular formula C29H26N2O7S and a molecular weight of 546.60 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-(6-ethyl-3-oxo-2-oxa-6-azatricyclo[5.3.1.04,8]undeca-1(11),4,7,9-tetraen-5-yl)-N-(4-propan-2-ylphenyl)sulfonylacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-(6-ethyl-3-oxo-2-oxa-6-azatricyclo[5.3.1.04,8]undeca-1(11),4,7,9-tetraen-5-yl)-N-(4-propan-2-ylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 70191260 |
| Molecular Formula | C29H26N2O7S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-(6-ethyl-3-oxo-2-oxa-6-azatricyclo[5.3.1.04,8]undeca-1(11),4,7,9-tetraen-5-yl)-N-(4-propan-2-ylphenyl)sulfonylacetamide |
| SMILES | CCn1c(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2c3ccc(cc31)OC2=O |
| InChI | InChI=1S/C29H26N2O7S/c1-4-31-22-14-19-8-11-21(22)26(29(33)38-19)27(31)25(18-7-12-23-24(13-18)37-15-36-23)28(32)30-39(34,35)20-9-5-17(6-10-20)16(2)3/h5-14,16,25H,4,15H2,1-3H3,(H,30,32) |
| InChIKey | QEMTWTBDHATUDN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|