C33H32O3 — CID 70191420
[4-[5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate (PubChem CID 70191420) has the molecular formula C33H32O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is [4-[5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70191420 |
| Molecular Formula | C33H32O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [4-[5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ccc(-c4ccccc4)cc3-c3ccc(OC(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C33H32O3/c1-32(2)18-19-33(3,4)30-21-25(13-17-29(30)32)27-16-12-24(22-8-6-5-7-9-22)20-28(27)23-10-14-26(15-11-23)36-31(34)35/h5-17,20-21H,18-19H2,1-4H3,(H,34,35) |
| InChIKey | MSGUUVUGYKVZFD-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|