C18H24N2O2 — CID 70191939
cyclopropyl-[4-[3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propoxy]phenyl]methanone (PubChem CID 70191939) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is cyclopropyl-[4-[3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propoxy]phenyl]methanone.
| Compound Name | cyclopropyl-[4-[3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 70191939 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | cyclopropyl-[4-[3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCCCN2C[C@@H]3C[C@H]2CN3)cc1)C1CC1 |
| InChI | InChI=1S/C18H24N2O2/c21-18(13-2-3-13)14-4-6-17(7-5-14)22-9-1-8-20-12-15-10-16(20)11-19-15/h4-7,13,15-16,19H,1-3,8-12H2/t15-,16-/m0/s1 |
| InChIKey | NYHMYDWHSIRGPJ-HOTGVXAUSA-N |
| XLogP | 2.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|