C9H15NO2 — CID 7019401
(E)-3-(dimethylamino)-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]prop-2-en-1-one (PubChem CID 7019401) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(dimethylamino)-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 7019401 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (E)-3-(dimethylamino)-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]prop-2-en-1-one |
| SMILES | C[C@H]1O[C@]1(C)C(=O)/C=C/N(C)C |
| InChI | InChI=1S/C9H15NO2/c1-7-9(2,12-7)8(11)5-6-10(3)4/h5-7H,1-4H3/b6-5+/t7-,9+/m1/s1 |
| InChIKey | ICKHRVJHIOZULB-FLHCDVKPSA-N |
| XLogP | 0.81 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|