C20H21Cl2NO3 — CID 70195286
3-(3,4-dichlorophenyl)-5-oxo-5-(3-phenylpropylamino)pentanoic acid (PubChem CID 70195286) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-oxo-5-(3-phenylpropylamino)pentanoic acid.
| Compound Name | 3-(3,4-dichlorophenyl)-5-oxo-5-(3-phenylpropylamino)pentanoic acid |
|---|---|
| PubChem CID | 70195286 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-oxo-5-(3-phenylpropylamino)pentanoic acid |
| SMILES | O=C(O)CC(CC(=O)NCCCc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2NO3/c21-17-9-8-15(11-18(17)22)16(13-20(25)26)12-19(24)23-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,23,24)(H,25,26) |
| InChIKey | HVLIYSLTWRLHIC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|