C29H23N3O4S — CID 70195646
1-methyl-3-(2-methyl-1H-indol-3-yl)-4-[2-(4-methylphenyl)sulfonyl-1H-indol-3-yl]pyrrole-2,5-dione (PubChem CID 70195646) has the molecular formula C29H23N3O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is 1-methyl-3-(2-methyl-1H-indol-3-yl)-4-[2-(4-methylphenyl)sulfonyl-1H-indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 1-methyl-3-(2-methyl-1H-indol-3-yl)-4-[2-(4-methylphenyl)sulfonyl-1H-indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70195646 |
| Molecular Formula | C29H23N3O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 1-methyl-3-(2-methyl-1H-indol-3-yl)-4-[2-(4-methylphenyl)sulfonyl-1H-indol-3-yl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)c2[nH]c3ccccc3c2C2=C(c3c(C)[nH]c4ccccc34)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C29H23N3O4S/c1-16-12-14-18(15-13-16)37(35,36)27-24(20-9-5-7-11-22(20)31-27)26-25(28(33)32(3)29(26)34)23-17(2)30-21-10-6-4-8-19(21)23/h4-15,30-31H,1-3H3 |
| InChIKey | GURMCVSLNSWCEI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|