C24H25N7O — CID 70200601
2-butyl-5-but-2-ynyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 70200601) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-butyl-5-but-2-ynyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butyl-5-but-2-ynyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70200601 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-butyl-5-but-2-ynyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | CC#CCc1nn(CCCC)c(=O)n1Cc1ccc(-c2cccc(-c3nn[nH]n3)c2)cc1 |
| InChI | InChI=1S/C24H25N7O/c1-3-5-10-22-27-31(15-6-4-2)24(32)30(22)17-18-11-13-19(14-12-18)20-8-7-9-21(16-20)23-25-28-29-26-23/h7-9,11-14,16H,4,6,10,15,17H2,1-2H3,(H,25,26,28,29) |
| InChIKey | QAIQZIBNTNWWDZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|