C25H31N7O — CID 70201999
5-tert-butyl-2-pentyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 70201999) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is 5-tert-butyl-2-pentyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 5-tert-butyl-2-pentyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70201999 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 5-tert-butyl-2-pentyl-4-[[4-[3-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | CCCCCn1nc(C(C)(C)C)n(Cc2ccc(-c3cccc(-c4nn[nH]n4)c3)cc2)c1=O |
| InChI | InChI=1S/C25H31N7O/c1-5-6-7-15-32-24(33)31(23(28-32)25(2,3)4)17-18-11-13-19(14-12-18)20-9-8-10-21(16-20)22-26-29-30-27-22/h8-14,16H,5-7,15,17H2,1-4H3,(H,26,27,29,30) |
| InChIKey | URJPVWFQGKZFEF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|