C10H9NO — CID 70203073
2,9-dihydro-3-benzazepin-6-one (PubChem CID 70203073) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 2,9-dihydro-3-benzazepin-6-one.
| Compound Name | 2,9-dihydro-3-benzazepin-6-one |
|---|---|
| PubChem CID | 70203073 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2,9-dihydro-3-benzazepin-6-one |
| SMILES | O=C1C=CCC2=CCN=CC=C12 |
| InChI | InChI=1S/C10H9NO/c12-10-3-1-2-8-4-6-11-7-5-9(8)10/h1,3-5,7H,2,6H2 |
| InChIKey | DYQQGVOULLWSDU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |