C21H29N3O4 — CID 70203770
[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenyl] butanoate (PubChem CID 70203770) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is [4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenyl] butanoate.
| Compound Name | [4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenyl] butanoate |
|---|---|
| PubChem CID | 70203770 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(C(=O)CN2CCN(C3CCNCC3)CC2=O)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-2-3-21(27)28-18-6-4-16(5-7-18)19(25)14-24-13-12-23(15-20(24)26)17-8-10-22-11-9-17/h4-7,17,22H,2-3,8-15H2,1H3 |
| InChIKey | BTUXKBMVSPEODC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|