C19H25N3O5 — CID 67657410
3-oxo-2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)-2-phenoxybutanoic acid (PubChem CID 67657410) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-oxo-2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)-2-phenoxybutanoic acid.
| Compound Name | 3-oxo-2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)-2-phenoxybutanoic acid |
|---|---|
| PubChem CID | 67657410 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-oxo-2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)-2-phenoxybutanoic acid |
| SMILES | CC(=O)C(Oc1ccccc1)(C(=O)O)N1CCN(C2CCNCC2)CC1=O |
| InChI | InChI=1S/C19H25N3O5/c1-14(23)19(18(25)26,27-16-5-3-2-4-6-16)22-12-11-21(13-17(22)24)15-7-9-20-10-8-15/h2-6,15,20H,7-13H2,1H3,(H,25,26) |
| InChIKey | OPLRPGNHSMQLQA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|