C21H28Cl5N3O5 — CID 18408910
2,2,2-trichloroethyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate;dihydrochloride (PubChem CID 18408910) has the molecular formula C21H28Cl5N3O5 and a molecular weight of 579.74 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate;dihydrochloride.
| Compound Name | 2,2,2-trichloroethyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate;dihydrochloride |
|---|---|
| PubChem CID | 18408910 |
| Molecular Formula | C21H28Cl5N3O5 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate;dihydrochloride |
| SMILES | Cl.Cl.O=C(COc1ccc(C(=O)CN2CCN(C3CCNCC3)CC2=O)cc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H26Cl3N3O5.2ClH/c22-21(23,24)14-32-20(30)13-31-17-3-1-15(2-4-17)18(28)11-27-10-9-26(12-19(27)29)16-5-7-25-8-6-16;;/h1-4,16,25H,5-14H2;2*1H |
| InChIKey | WVOFMTRMJHTMAF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|