C19H18FNO3S — CID 70204843
[4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-1H-pyrrol-3-yl]methanol (PubChem CID 70204843) has the molecular formula C19H18FNO3S and a molecular weight of 359.42 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-1H-pyrrol-3-yl]methanol.
| Compound Name | [4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-1H-pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 70204843 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-1H-pyrrol-3-yl]methanol |
| SMILES | Cc1[nH]c(-c2ccc(S(C)(=O)=O)cc2)c(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C19H18FNO3S/c1-12-17(11-22)18(13-3-7-15(20)8-4-13)19(21-12)14-5-9-16(10-6-14)25(2,23)24/h3-10,21-22H,11H2,1-2H3 |
| InChIKey | AWBGLMAOYLJDEA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |