C19H22N2O4 — CID 70207438
(2-acetyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl) cyclobutanecarboxylate (PubChem CID 70207438) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2-acetyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl) cyclobutanecarboxylate.
| Compound Name | (2-acetyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl) cyclobutanecarboxylate |
|---|---|
| PubChem CID | 70207438 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2-acetyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl) cyclobutanecarboxylate |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(C)=O)C3OC(=O)C1CCC1 |
| InChI | InChI=1S/C19H22N2O4/c1-11(22)21-9-8-14-15-10-13(24-2)6-7-16(15)20-17(14)18(21)25-19(23)12-4-3-5-12/h6-7,10,12,18,20H,3-5,8-9H2,1-2H3 |
| InChIKey | YJNIKHIRMRZQDH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|