C36H37F3N4O5S2 — CID 70208313
6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1H-pyrimidine-2,4-dione;6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 70208313) has the molecular formula C36H37F3N4O5S2 and a molecular weight of 726.84 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1H-pyrimidine-2,4-dione;6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione.
| Compound Name | 6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1H-pyrimidine-2,4-dione;6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70208313 |
| Molecular Formula | C36H37F3N4O5S2 |
| Molecular Weight | 726.84 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | 6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1H-pyrimidine-2,4-dione;6-(3,5-dimethylphenyl)sulfanyl-5-ethyl-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | CCc1c(Sc2cc(C)cc(C)c2)[nH]c(=O)[nH]c1=O.CCc1c(Sc2cc(C)cc(C)c2)n(Cc2ccc(OC(F)(F)F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H21F3N2O3S.C14H16N2O2S/c1-4-18-19(28)26-21(29)27(20(18)31-17-10-13(2)9-14(3)11-17)12-15-5-7-16(8-6-15)30-22(23,24)25;1-4-11-12(17)15-14(18)16-13(11)19-10-6-8(2)5-9(3)7-10/h5-11H,4,12H2,1-3H3,(H,26,28,29);5-7H,4H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | QOMQOYFVMXGXBL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.84 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |