C16H15BrO2S — CID 70208606
5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene (PubChem CID 70208606) has the molecular formula C16H15BrO2S and a molecular weight of 351.27 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 70208606 |
| Molecular Formula | C16H15BrO2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene |
| SMILES | O=S(=O)(Cc1ccc2c(c1)CCC2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrO2S/c17-15-6-8-16(9-7-15)20(18,19)11-12-4-5-13-2-1-3-14(13)10-12/h4-10H,1-3,11H2 |
| InChIKey | ANKRXQFRDHJOAK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |