C22H30BrNO2S — CID 70208605
5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene;N-propylpropan-1-amine (PubChem CID 70208605) has the molecular formula C22H30BrNO2S and a molecular weight of 452.46 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene;N-propylpropan-1-amine.
| Compound Name | 5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene;N-propylpropan-1-amine |
|---|---|
| PubChem CID | 70208605 |
| Molecular Formula | C22H30BrNO2S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 5-[(4-bromophenyl)sulfonylmethyl]-2,3-dihydro-1H-indene;N-propylpropan-1-amine |
| SMILES | CCCNCCC.O=S(=O)(Cc1ccc2c(c1)CCC2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrO2S.C6H15N/c17-15-6-8-16(9-7-15)20(18,19)11-12-4-5-13-2-1-3-14(13)10-12;1-3-5-7-6-4-2/h4-10H,1-3,11H2;7H,3-6H2,1-2H3 |
| InChIKey | OENVAGQOHNWJNS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|