C16H16ClNO2S — CID 81185321
3-chloro-2-(2,3-dihydro-1H-inden-5-ylmethylsulfonyl)aniline (PubChem CID 81185321) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is 3-chloro-2-(2,3-dihydro-1H-inden-5-ylmethylsulfonyl)aniline.
| Compound Name | 3-chloro-2-(2,3-dihydro-1H-inden-5-ylmethylsulfonyl)aniline |
|---|---|
| PubChem CID | 81185321 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-chloro-2-(2,3-dihydro-1H-inden-5-ylmethylsulfonyl)aniline |
| SMILES | Nc1cccc(Cl)c1S(=O)(=O)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H16ClNO2S/c17-14-5-2-6-15(18)16(14)21(19,20)10-11-7-8-12-3-1-4-13(12)9-11/h2,5-9H,1,3-4,10,18H2 |
| InChIKey | XPEQIPJEKXRDPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|