C33H36N4O6S — CID 70208846
2-[[2-[4-[5-[4-[3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 70208846) has the molecular formula C33H36N4O6S and a molecular weight of 616.74 g/mol. Its IUPAC name is 2-[[2-[4-[5-[4-[3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[4-[5-[4-[3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 70208846 |
| Molecular Formula | C33H36N4O6S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 2-[[2-[4-[5-[4-[3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCCCCCNC(=O)C=Cc1ccc(-c2sc(-c3ccc[nH]3)nc2-c2ccc(OCC(=O)NC(CO)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H36N4O6S/c1-2-3-4-5-18-35-28(39)17-10-22-8-11-24(12-9-22)31-30(37-32(44-31)26-7-6-19-34-26)23-13-15-25(16-14-23)43-21-29(40)36-27(20-38)33(41)42/h6-17,19,27,34,38H,2-5,18,20-21H2,1H3,(H,35,39)(H,36,40)(H,41,42) |
| InChIKey | ZXFHYAFMCUJGQD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|