C21H28ClFN6O4S — CID 70209322
methyl 2-[2-[[4-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]cyclohexyl]sulfamoyl]ethylamino]acetate (PubChem CID 70209322) has the molecular formula C21H28ClFN6O4S and a molecular weight of 515.01 g/mol. Its IUPAC name is methyl 2-[2-[[4-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]cyclohexyl]sulfamoyl]ethylamino]acetate.
| Compound Name | methyl 2-[2-[[4-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]cyclohexyl]sulfamoyl]ethylamino]acetate |
|---|---|
| PubChem CID | 70209322 |
| Molecular Formula | C21H28ClFN6O4S |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | methyl 2-[2-[[4-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]cyclohexyl]sulfamoyl]ethylamino]acetate |
| SMILES | COC(=O)CNCCS(=O)(=O)NC1CCC(Nc2cc(Nc3ccc(F)c(Cl)c3)ncn2)CC1 |
| InChI | InChI=1S/C21H28ClFN6O4S/c1-33-21(30)12-24-8-9-34(31,32)29-15-4-2-14(3-5-15)27-19-11-20(26-13-25-19)28-16-6-7-18(23)17(22)10-16/h6-7,10-11,13-15,24,29H,2-5,8-9,12H2,1H3,(H2,25,26,27,28) |
| InChIKey | BLXMQXNLXRNTAQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|