C30H42N2O4 — CID 70209847
7-[3-[(2-hydroxybenzoyl)amino]-2,2-dimethylpropyl]-6-methyl-1-octyl-2,3-dihydroindole-5-carboxylic acid (PubChem CID 70209847) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 7-[3-[(2-hydroxybenzoyl)amino]-2,2-dimethylpropyl]-6-methyl-1-octyl-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 7-[3-[(2-hydroxybenzoyl)amino]-2,2-dimethylpropyl]-6-methyl-1-octyl-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 70209847 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 7-[3-[(2-hydroxybenzoyl)amino]-2,2-dimethylpropyl]-6-methyl-1-octyl-2,3-dihydroindole-5-carboxylic acid |
| SMILES | CCCCCCCCN1CCc2cc(C(=O)O)c(C)c(CC(C)(C)CNC(=O)c3ccccc3O)c21 |
| InChI | InChI=1S/C30H42N2O4/c1-5-6-7-8-9-12-16-32-17-15-22-18-24(29(35)36)21(2)25(27(22)32)19-30(3,4)20-31-28(34)23-13-10-11-14-26(23)33/h10-11,13-14,18,33H,5-9,12,15-17,19-20H2,1-4H3,(H,31,34)(H,35,36) |
| InChIKey | QNPPAZVSOPECBO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|