C19H28N2O4 — CID 22247299
methyl 6-methyl-7-nitro-1-octyl-2,3-dihydroindole-5-carboxylate (PubChem CID 22247299) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is methyl 6-methyl-7-nitro-1-octyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 6-methyl-7-nitro-1-octyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 22247299 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | methyl 6-methyl-7-nitro-1-octyl-2,3-dihydroindole-5-carboxylate |
| SMILES | CCCCCCCCN1CCc2cc(C(=O)OC)c(C)c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C19H28N2O4/c1-4-5-6-7-8-9-11-20-12-10-15-13-16(19(22)25-3)14(2)17(18(15)20)21(23)24/h13H,4-12H2,1-3H3 |
| InChIKey | VLEMMABYALUDEV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|