C16H23BrN2O2 — CID 10641899
5-bromo-1-hexyl-4,6-dimethyl-7-nitro-2,3-dihydroindole (PubChem CID 10641899) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 5-bromo-1-hexyl-4,6-dimethyl-7-nitro-2,3-dihydroindole.
| Compound Name | 5-bromo-1-hexyl-4,6-dimethyl-7-nitro-2,3-dihydroindole |
|---|---|
| PubChem CID | 10641899 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-bromo-1-hexyl-4,6-dimethyl-7-nitro-2,3-dihydroindole |
| SMILES | CCCCCCN1CCc2c(C)c(Br)c(C)c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C16H23BrN2O2/c1-4-5-6-7-9-18-10-8-13-11(2)14(17)12(3)15(16(13)18)19(20)21/h4-10H2,1-3H3 |
| InChIKey | MXASZZFQZCSSHI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|