C21H35N3O3S — CID 10092947
N-[5-(methanesulfonamido)-4,6-dimethyl-1-pentyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide (PubChem CID 10092947) has the molecular formula C21H35N3O3S and a molecular weight of 409.60 g/mol. Its IUPAC name is N-[5-(methanesulfonamido)-4,6-dimethyl-1-pentyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-(methanesulfonamido)-4,6-dimethyl-1-pentyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 10092947 |
| Molecular Formula | C21H35N3O3S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[5-(methanesulfonamido)-4,6-dimethyl-1-pentyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide |
| SMILES | CCCCCN1CCc2c(C)c(NS(C)(=O)=O)c(C)c(NC(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C21H35N3O3S/c1-8-9-10-12-24-13-11-16-14(2)17(23-28(7,26)27)15(3)18(19(16)24)22-20(25)21(4,5)6/h23H,8-13H2,1-7H3,(H,22,25) |
| InChIKey | RBKNPTJINPQTRO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|