C26H45N3O3S — CID 10367852
N-[4,6-dimethyl-7-(propylsulfonylamino)-2,3-dihydro-1H-indol-5-yl]-2,2-dimethylundecanamide (PubChem CID 10367852) has the molecular formula C26H45N3O3S and a molecular weight of 479.73 g/mol. Its IUPAC name is N-[4,6-dimethyl-7-(propylsulfonylamino)-2,3-dihydro-1H-indol-5-yl]-2,2-dimethylundecanamide.
| Compound Name | N-[4,6-dimethyl-7-(propylsulfonylamino)-2,3-dihydro-1H-indol-5-yl]-2,2-dimethylundecanamide |
|---|---|
| PubChem CID | 10367852 |
| Molecular Formula | C26H45N3O3S |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | N-[4,6-dimethyl-7-(propylsulfonylamino)-2,3-dihydro-1H-indol-5-yl]-2,2-dimethylundecanamide |
| SMILES | CCCCCCCCCC(C)(C)C(=O)Nc1c(C)c2c(c(NS(=O)(=O)CCC)c1C)NCC2 |
| InChI | InChI=1S/C26H45N3O3S/c1-7-9-10-11-12-13-14-16-26(5,6)25(30)28-22-19(3)21-15-17-27-24(21)23(20(22)4)29-33(31,32)18-8-2/h27,29H,7-18H2,1-6H3,(H,28,30) |
| InChIKey | JZAQKAVLSUUQAF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|