C26H43N3O3 — CID 174520925
tert-butyl N-[5-(2,2-dimethylundecanoylamino)-2,3-dihydro-1H-indol-7-yl]carbamate (PubChem CID 174520925) has the molecular formula C26H43N3O3 and a molecular weight of 445.65 g/mol. Its IUPAC name is tert-butyl N-[5-(2,2-dimethylundecanoylamino)-2,3-dihydro-1H-indol-7-yl]carbamate.
| Compound Name | tert-butyl N-[5-(2,2-dimethylundecanoylamino)-2,3-dihydro-1H-indol-7-yl]carbamate |
|---|---|
| PubChem CID | 174520925 |
| Molecular Formula | C26H43N3O3 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | tert-butyl N-[5-(2,2-dimethylundecanoylamino)-2,3-dihydro-1H-indol-7-yl]carbamate |
| SMILES | CCCCCCCCCC(C)(C)C(=O)Nc1cc2c(c(NC(=O)OC(C)(C)C)c1)NCC2 |
| InChI | InChI=1S/C26H43N3O3/c1-7-8-9-10-11-12-13-15-26(5,6)23(30)28-20-17-19-14-16-27-22(19)21(18-20)29-24(31)32-25(2,3)4/h17-18,27H,7-16H2,1-6H3,(H,28,30)(H,29,31) |
| InChIKey | NLCDAXFVJRCZGF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|