C25H40N2O3 — CID 68754753
2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-(6-methylheptyl)-2,3-dihydroindol-5-yl]acetic acid (PubChem CID 68754753) has the molecular formula C25H40N2O3 and a molecular weight of 416.61 g/mol. Its IUPAC name is 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-(6-methylheptyl)-2,3-dihydroindol-5-yl]acetic acid.
| Compound Name | 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-(6-methylheptyl)-2,3-dihydroindol-5-yl]acetic acid |
|---|---|
| PubChem CID | 68754753 |
| Molecular Formula | C25H40N2O3 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-(6-methylheptyl)-2,3-dihydroindol-5-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c(C)c(NC(=O)C(C)(C)C)c2c1CCN2CCCCCC(C)C |
| InChI | InChI=1S/C25H40N2O3/c1-16(2)11-9-8-10-13-27-14-12-19-17(3)20(15-21(28)29)18(4)22(23(19)27)26-24(30)25(5,6)7/h16H,8-15H2,1-7H3,(H,26,30)(H,28,29) |
| InChIKey | KZZOVFDFEINKQE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|