C28H60O10 — CID 88729914
bis(2,2-bis(hydroxymethyl)propane-1,3-diol);16-methylheptadecanoic acid (PubChem CID 88729914) has the molecular formula C28H60O10 and a molecular weight of 556.78 g/mol. Its IUPAC name is bis(2,2-bis(hydroxymethyl)propane-1,3-diol);16-methylheptadecanoic acid.
| Compound Name | bis(2,2-bis(hydroxymethyl)propane-1,3-diol);16-methylheptadecanoic acid |
|---|---|
| PubChem CID | 88729914 |
| Molecular Formula | C28H60O10 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.42 |
| IUPAC Name | bis(2,2-bis(hydroxymethyl)propane-1,3-diol);16-methylheptadecanoic acid |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O.OCC(CO)(CO)CO.OCC(CO)(CO)CO |
| InChI | InChI=1S/C18H36O2.2C5H12O4/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;2*6-1-5(2-7,3-8)4-9/h17H,3-16H2,1-2H3,(H,19,20);2*6-9H,1-4H2 |
| InChIKey | OSFSCOZVYPPOIF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 199.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|