C26H42N2O3 — CID 22247343
2-[8-(2,2-dimethylpropanoylamino)-5,7-dimethyl-1-octyl-3,4-dihydro-2H-quinolin-6-yl]acetic acid (PubChem CID 22247343) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-[8-(2,2-dimethylpropanoylamino)-5,7-dimethyl-1-octyl-3,4-dihydro-2H-quinolin-6-yl]acetic acid.
| Compound Name | 2-[8-(2,2-dimethylpropanoylamino)-5,7-dimethyl-1-octyl-3,4-dihydro-2H-quinolin-6-yl]acetic acid |
|---|---|
| PubChem CID | 22247343 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 2-[8-(2,2-dimethylpropanoylamino)-5,7-dimethyl-1-octyl-3,4-dihydro-2H-quinolin-6-yl]acetic acid |
| SMILES | CCCCCCCCN1CCCc2c(C)c(CC(=O)O)c(C)c(NC(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C26H42N2O3/c1-7-8-9-10-11-12-15-28-16-13-14-20-18(2)21(17-22(29)30)19(3)23(24(20)28)27-25(31)26(4,5)6/h7-17H2,1-6H3,(H,27,31)(H,29,30) |
| InChIKey | JYTYDPDPAWFWOU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|