C19H18Br2N4O4 — CID 71507942
5,13-dibromo-3,6,11,14-tetramethyl-4,12-dinitro-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene (PubChem CID 71507942) has the molecular formula C19H18Br2N4O4 and a molecular weight of 526.19 g/mol. Its IUPAC name is 5,13-dibromo-3,6,11,14-tetramethyl-4,12-dinitro-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene.
| Compound Name | 5,13-dibromo-3,6,11,14-tetramethyl-4,12-dinitro-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 71507942 |
| Molecular Formula | C19H18Br2N4O4 |
| Molecular Weight | 526.19 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 5,13-dibromo-3,6,11,14-tetramethyl-4,12-dinitro-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
| SMILES | Cc1c(Br)c([N+](=O)[O-])c(C)c2c1CN1CN2Cc2c(C)c(Br)c([N+](=O)[O-])c(C)c21 |
| InChI | InChI=1S/C19H18Br2N4O4/c1-8-12-5-22-7-23(16(12)10(3)18(14(8)20)24(26)27)6-13-9(2)15(21)19(25(28)29)11(4)17(13)22/h5-7H2,1-4H3 |
| InChIKey | DCIWSMIQLXRWBH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.19 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|